C17H21NO — CID 116605647
(E)-4-(4-aminophenyl)-1-(2-bicyclo[2.2.1]heptanyl)but-3-en-2-one (PubChem CID 116605647) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (E)-4-(4-aminophenyl)-1-(2-bicyclo[2.2.1]heptanyl)but-3-en-2-one.
| Compound Name | (E)-4-(4-aminophenyl)-1-(2-bicyclo[2.2.1]heptanyl)but-3-en-2-one |
|---|---|
| PubChem CID | 116605647 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (E)-4-(4-aminophenyl)-1-(2-bicyclo[2.2.1]heptanyl)but-3-en-2-one |
| SMILES | Nc1ccc(/C=C/C(=O)CC2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C17H21NO/c18-16-6-2-12(3-7-16)4-8-17(19)11-15-10-13-1-5-14(15)9-13/h2-4,6-8,13-15H,1,5,9-11,18H2/b8-4+ |
| InChIKey | ZQFXPIZTGNTQQB-XBXARRHUSA-N |
| XLogP | 3.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|