C14H20N2O — CID 116613730
(3-amino-2-pyridinyl)-(3,4-dimethylcyclohexyl)methanone (PubChem CID 116613730) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (3-amino-2-pyridinyl)-(3,4-dimethylcyclohexyl)methanone.
| Compound Name | (3-amino-2-pyridinyl)-(3,4-dimethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 116613730 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (3-amino-2-pyridinyl)-(3,4-dimethylcyclohexyl)methanone |
| SMILES | CC1CCC(C(=O)c2ncccc2N)CC1C |
| InChI | InChI=1S/C14H20N2O/c1-9-5-6-11(8-10(9)2)14(17)13-12(15)4-3-7-16-13/h3-4,7,9-11H,5-6,8,15H2,1-2H3 |
| InChIKey | KYKBFNVAAGMORH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |