C29H24N2O5 — CID 11662996
ethyl 2-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-4-phenylquinoline-3-carboxylate (PubChem CID 11662996) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-4-phenylquinoline-3-carboxylate.
| Compound Name | ethyl 2-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-4-phenylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11662996 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | ethyl 2-[2-(1,3-dioxoisoindol-2-yl)ethoxymethyl]-4-phenylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(COCCN2C(=O)c3ccccc3C2=O)nc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C29H24N2O5/c1-2-36-29(34)26-24(18-35-17-16-31-27(32)20-12-6-7-13-21(20)28(31)33)30-23-15-9-8-14-22(23)25(26)19-10-4-3-5-11-19/h3-15H,2,16-18H2,1H3 |
| InChIKey | DRNQQGOTSHAISL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|