C20H21F3N4O8 — CID 11663379
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-azido-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate (PubChem CID 11663379) has the molecular formula C20H21F3N4O8 and a molecular weight of 502.40 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-azido-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-azido-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11663379 |
| Molecular Formula | C20H21F3N4O8 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-azido-6-[N-phenyl-C-(trifluoromethyl)carbonimidoyl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(O/C(=N/c2ccccc2)C(F)(F)F)[C@H](N=[N+]=[N-])[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H21F3N4O8/c1-10(28)31-9-14-16(32-11(2)29)17(33-12(3)30)15(26-27-24)18(34-14)35-19(20(21,22)23)25-13-7-5-4-6-8-13/h4-8,14-18H,9H2,1-3H3/b25-19+/t14-,15-,16+,17-,18?/m1/s1 |
| InChIKey | YQASFZLFSAJLEH-DNYFRJECSA-N |
| XLogP | 3.13 |
| TPSA | 158.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|