C23H32O14 — CID 11663751
[(2R,3R,4S,5R,6S,7S)-2,3,4,5,6,7-hexaacetyloxynon-8-enyl] acetate (PubChem CID 11663751) has the molecular formula C23H32O14 and a molecular weight of 532.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S,7S)-2,3,4,5,6,7-hexaacetyloxynon-8-enyl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S,7S)-2,3,4,5,6,7-hexaacetyloxynon-8-enyl] acetate |
|---|---|
| PubChem CID | 11663751 |
| Molecular Formula | C23H32O14 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S,7S)-2,3,4,5,6,7-hexaacetyloxynon-8-enyl] acetate |
| SMILES | C=C[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C23H32O14/c1-9-18(32-12(3)25)20(34-14(5)27)22(36-16(7)29)23(37-17(8)30)21(35-15(6)28)19(33-13(4)26)10-31-11(2)24/h9,18-23H,1,10H2,2-8H3/t18-,19+,20-,21+,22+,23-/m0/s1 |
| InChIKey | HEZOKFOLGBGGIW-WQANTMLLSA-N |
| XLogP | 0.33 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|