C15H14N2O — CID 116642434
2-(3-naphthalen-1-yl-1,2-oxazol-5-yl)ethanamine (PubChem CID 116642434) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(3-naphthalen-1-yl-1,2-oxazol-5-yl)ethanamine.
| Compound Name | 2-(3-naphthalen-1-yl-1,2-oxazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 116642434 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-(3-naphthalen-1-yl-1,2-oxazol-5-yl)ethanamine |
| SMILES | NCCc1cc(-c2cccc3ccccc23)no1 |
| InChI | InChI=1S/C15H14N2O/c16-9-8-12-10-15(17-18-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-7,10H,8-9,16H2 |
| InChIKey | MEKJTYHRKURFBI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |