C15H19NO3 — CID 143675910
5-butyl-3-(2,3-dimethoxyphenyl)-1,2-oxazole (PubChem CID 143675910) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-butyl-3-(2,3-dimethoxyphenyl)-1,2-oxazole.
| Compound Name | 5-butyl-3-(2,3-dimethoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 143675910 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 5-butyl-3-(2,3-dimethoxyphenyl)-1,2-oxazole |
| SMILES | CCCCc1cc(-c2cccc(OC)c2OC)no1 |
| InChI | InChI=1S/C15H19NO3/c1-4-5-7-11-10-13(16-19-11)12-8-6-9-14(17-2)15(12)18-3/h6,8-10H,4-5,7H2,1-3H3 |
| InChIKey | ABRYADDCFNNURT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |