C13H26OSi — CID 11665763
tert-butyl-dimethyl-(3-methyl-4-methylidenecyclopentyl)oxysilane (PubChem CID 11665763) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3-methyl-4-methylidenecyclopentyl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(3-methyl-4-methylidenecyclopentyl)oxysilane |
|---|---|
| PubChem CID | 11665763 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | tert-butyl-dimethyl-(3-methyl-4-methylidenecyclopentyl)oxysilane |
| SMILES | C=C1CC(O[Si](C)(C)C(C)(C)C)CC1C |
| InChI | InChI=1S/C13H26OSi/c1-10-8-12(9-11(10)2)14-15(6,7)13(3,4)5/h11-12H,1,8-9H2,2-7H3 |
| InChIKey | GTWMTYKDLDKNNI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|