C16H32O2Si — CID 123620398
ditert-butyl-methoxy-(2-methyl-3-methylidenecyclopentyl)oxysilane (PubChem CID 123620398) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is ditert-butyl-methoxy-(2-methyl-3-methylidenecyclopentyl)oxysilane.
| Compound Name | ditert-butyl-methoxy-(2-methyl-3-methylidenecyclopentyl)oxysilane |
|---|---|
| PubChem CID | 123620398 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | ditert-butyl-methoxy-(2-methyl-3-methylidenecyclopentyl)oxysilane |
| SMILES | C=C1CCC(O[Si](OC)(C(C)(C)C)C(C)(C)C)C1C |
| InChI | InChI=1S/C16H32O2Si/c1-12-10-11-14(13(12)2)18-19(17-9,15(3,4)5)16(6,7)8/h13-14H,1,10-11H2,2-9H3 |
| InChIKey | DVCRLBWZASLULJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|