C20H40OSi — CID 10791527
(2-methyl-3-pentylidenecyclopentyl)oxy-tri(propan-2-yl)silane (PubChem CID 10791527) has the molecular formula C20H40OSi and a molecular weight of 324.63 g/mol. Its IUPAC name is (2-methyl-3-pentylidenecyclopentyl)oxy-tri(propan-2-yl)silane.
| Compound Name | (2-methyl-3-pentylidenecyclopentyl)oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10791527 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.63 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | (2-methyl-3-pentylidenecyclopentyl)oxy-tri(propan-2-yl)silane |
| SMILES | CCCCC=C1CCC(O[Si](C(C)C)(C(C)C)C(C)C)C1C |
| InChI | InChI=1S/C20H40OSi/c1-9-10-11-12-19-13-14-20(18(19)8)21-22(15(2)3,16(4)5)17(6)7/h12,15-18,20H,9-11,13-14H2,1-8H3 |
| InChIKey | CJASOVKMKDKTMV-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.63 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|