C6H10N4O2 — CID 116658012
1,1-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)urea (PubChem CID 116658012) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1,1-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)urea.
| Compound Name | 1,1-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)urea |
|---|---|
| PubChem CID | 116658012 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1,1-dimethyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)urea |
| SMILES | Cc1noc(NC(=O)N(C)C)n1 |
| InChI | InChI=1S/C6H10N4O2/c1-4-7-5(12-9-4)8-6(11)10(2)3/h1-3H3,(H,7,8,9,11) |
| InChIKey | HKUGUIDOIBMEEJ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |