C13H17ClO2 — CID 11665895
5-chloro-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 11665895) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is 5-chloro-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 5-chloro-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 11665895 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-chloro-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(Cl)c1O)CCC(C)(C)O2 |
| InChI | InChI=1S/C13H17ClO2/c1-7-8(2)12-9(10(14)11(7)15)5-6-13(3,4)16-12/h15H,5-6H2,1-4H3 |
| InChIKey | MVNSUAVFKVGVAJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |