C28H27FN4O2S — CID 1166607
2-[2-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-5-(4-fluorophenyl)imidazol-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 1166607) has the molecular formula C28H27FN4O2S and a molecular weight of 502.62 g/mol. Its IUPAC name is 2-[2-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-5-(4-fluorophenyl)imidazol-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-5-(4-fluorophenyl)imidazol-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 1166607 |
| Molecular Formula | C28H27FN4O2S |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-[2-[2-(2,6-dimethylanilino)-2-oxoethyl]sulfanyl-5-(4-fluorophenyl)imidazol-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(-c3ccc(F)cc3)cnc2SCC(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C28H27FN4O2S/c1-18-7-13-23(14-8-18)31-25(34)16-33-24(21-9-11-22(29)12-10-21)15-30-28(33)36-17-26(35)32-27-19(2)5-4-6-20(27)3/h4-15H,16-17H2,1-3H3,(H,31,34)(H,32,35) |
| InChIKey | JDSFJMLOEZIBOA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|