C25H21FN4O3S — CID 1432612
2-[5-(4-fluorophenyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide (PubChem CID 1432612) has the molecular formula C25H21FN4O3S and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[5-(4-fluorophenyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1432612 |
| Molecular Formula | C25H21FN4O3S |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-1-[(4-methylphenyl)methyl]imidazol-2-yl]sulfanyl-N-(3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(Cn2c(-c3ccc(F)cc3)cnc2SCC(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C25H21FN4O3S/c1-17-5-7-18(8-6-17)15-29-23(19-9-11-20(26)12-10-19)14-27-25(29)34-16-24(31)28-21-3-2-4-22(13-21)30(32)33/h2-14H,15-16H2,1H3,(H,28,31) |
| InChIKey | WZZNLAWTGLNQLY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|