C26H23FN4O6S — CID 3168717
ethyl 2-(N-[2-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]-3-nitroanilino)acetate (PubChem CID 3168717) has the molecular formula C26H23FN4O6S and a molecular weight of 538.56 g/mol. Its IUPAC name is ethyl 2-(N-[2-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]-3-nitroanilino)acetate.
| Compound Name | ethyl 2-(N-[2-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]-3-nitroanilino)acetate |
|---|---|
| PubChem CID | 3168717 |
| Molecular Formula | C26H23FN4O6S |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | ethyl 2-(N-[2-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylacetyl]-3-nitroanilino)acetate |
| SMILES | CCOC(=O)CN(C(=O)CSc1ncc(-c2ccc(F)cc2)n1Cc1ccco1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H23FN4O6S/c1-2-36-25(33)16-29(20-5-3-6-21(13-20)31(34)35)24(32)17-38-26-28-14-23(18-8-10-19(27)11-9-18)30(26)15-22-7-4-12-37-22/h3-14H,2,15-17H2,1H3 |
| InChIKey | GNAZNTXLCLXJKY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 120.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|