C14H15N5O5S — CID 41342292
2-[5-(hydroxymethyl)-2-[2-(3-nitroanilino)-2-oxoethyl]sulfanylimidazol-1-yl]acetamide (PubChem CID 41342292) has the molecular formula C14H15N5O5S and a molecular weight of 365.37 g/mol. Its IUPAC name is 2-[5-(hydroxymethyl)-2-[2-(3-nitroanilino)-2-oxoethyl]sulfanylimidazol-1-yl]acetamide.
| Compound Name | 2-[5-(hydroxymethyl)-2-[2-(3-nitroanilino)-2-oxoethyl]sulfanylimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 41342292 |
| Molecular Formula | C14H15N5O5S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2-[5-(hydroxymethyl)-2-[2-(3-nitroanilino)-2-oxoethyl]sulfanylimidazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1c(CO)cnc1SCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N5O5S/c15-12(21)6-18-11(7-20)5-16-14(18)25-8-13(22)17-9-2-1-3-10(4-9)19(23)24/h1-5,20H,6-8H2,(H2,15,21)(H,17,22) |
| InChIKey | YHUQRVVTAOOTDU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|