C19H28O6 — CID 11667502
ethyl 2,2-dimethyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]prop-2-enyl]-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 11667502) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]prop-2-enyl]-4,6-dioxocyclohexane-1-carboxylate.
| Compound Name | ethyl 2,2-dimethyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]prop-2-enyl]-4,6-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11667502 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethyl 2,2-dimethyl-5-[2-[(2-methylpropan-2-yl)oxycarbonyl]prop-2-enyl]-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | C=C(CC1C(=O)CC(C)(C)C(C(=O)OCC)C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28O6/c1-8-24-17(23)14-15(21)12(13(20)10-19(14,6)7)9-11(2)16(22)25-18(3,4)5/h12,14H,2,8-10H2,1,3-7H3 |
| InChIKey | MKPGMNQHNJPFCI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|