C15H24N4O4S2 — CID 11668223
1-[2-(4-oxooxetan-2-yl)ethyl]-3-[3-[2-(4-oxooxetan-2-yl)ethylcarbamothioylamino]propyl]thiourea (PubChem CID 11668223) has the molecular formula C15H24N4O4S2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-[2-(4-oxooxetan-2-yl)ethyl]-3-[3-[2-(4-oxooxetan-2-yl)ethylcarbamothioylamino]propyl]thiourea.
| Compound Name | 1-[2-(4-oxooxetan-2-yl)ethyl]-3-[3-[2-(4-oxooxetan-2-yl)ethylcarbamothioylamino]propyl]thiourea |
|---|---|
| PubChem CID | 11668223 |
| Molecular Formula | C15H24N4O4S2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[2-(4-oxooxetan-2-yl)ethyl]-3-[3-[2-(4-oxooxetan-2-yl)ethylcarbamothioylamino]propyl]thiourea |
| SMILES | O=C1CC(CCNC(=S)NCCCNC(=S)NCCC2CC(=O)O2)O1 |
| InChI | InChI=1S/C15H24N4O4S2/c20-12-8-10(22-12)2-6-18-14(24)16-4-1-5-17-15(25)19-7-3-11-9-13(21)23-11/h10-11H,1-9H2,(H2,16,18,24)(H2,17,19,25) |
| InChIKey | QUHWZPNVCCSORX-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|