C21H36N2O4S — CID 11429856
1,3-bis[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea (PubChem CID 11429856) has the molecular formula C21H36N2O4S and a molecular weight of 412.60 g/mol. Its IUPAC name is 1,3-bis[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea.
| Compound Name | 1,3-bis[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea |
|---|---|
| PubChem CID | 11429856 |
| Molecular Formula | C21H36N2O4S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1,3-bis[4-methyl-4-(5-oxooxolan-3-yl)pentyl]thiourea |
| SMILES | CC(C)(CCCNC(=S)NCCCC(C)(C)C1COC(=O)C1)C1COC(=O)C1 |
| InChI | InChI=1S/C21H36N2O4S/c1-20(2,15-11-17(24)26-13-15)7-5-9-22-19(28)23-10-6-8-21(3,4)16-12-18(25)27-14-16/h15-16H,5-14H2,1-4H3,(H2,22,23,28) |
| InChIKey | GLWKVGGQTQRTMA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|