C12H18O6 — CID 129188360
2-(4,9-dioxo-1,5-dioxonan-7-yl)-2-methylbutanoic acid (PubChem CID 129188360) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(4,9-dioxo-1,5-dioxonan-7-yl)-2-methylbutanoic acid.
| Compound Name | 2-(4,9-dioxo-1,5-dioxonan-7-yl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 129188360 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-(4,9-dioxo-1,5-dioxonan-7-yl)-2-methylbutanoic acid |
| SMILES | CCC(C)(C(=O)O)C1COC(=O)CCOC(=O)C1 |
| InChI | InChI=1S/C12H18O6/c1-3-12(2,11(15)16)8-6-10(14)17-5-4-9(13)18-7-8/h8H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | MMQCDNFKTBFITQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |