C17H30O4 — CID 138742562
4-[5-(5-hydroxyoxolan-3-yl)-2,5-dimethylhexan-2-yl]oxan-2-one (PubChem CID 138742562) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-[5-(5-hydroxyoxolan-3-yl)-2,5-dimethylhexan-2-yl]oxan-2-one.
| Compound Name | 4-[5-(5-hydroxyoxolan-3-yl)-2,5-dimethylhexan-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 138742562 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 4-[5-(5-hydroxyoxolan-3-yl)-2,5-dimethylhexan-2-yl]oxan-2-one |
| SMILES | CC(C)(CCC(C)(C)C1COC(O)C1)C1CCOC(=O)C1 |
| InChI | InChI=1S/C17H30O4/c1-16(2,12-5-8-20-14(18)9-12)6-7-17(3,4)13-10-15(19)21-11-13/h12-13,15,19H,5-11H2,1-4H3 |
| InChIKey | KJJRWKUPASOLLL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |