C23H38O5 — CID 68581784
5-[2,12-dimethyl-7-oxo-12-(5-oxooxolan-3-yl)tridecan-2-yl]oxolan-2-one (PubChem CID 68581784) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is 5-[2,12-dimethyl-7-oxo-12-(5-oxooxolan-3-yl)tridecan-2-yl]oxolan-2-one.
| Compound Name | 5-[2,12-dimethyl-7-oxo-12-(5-oxooxolan-3-yl)tridecan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 68581784 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 5-[2,12-dimethyl-7-oxo-12-(5-oxooxolan-3-yl)tridecan-2-yl]oxolan-2-one |
| SMILES | CC(C)(CCCCC(=O)CCCCC(C)(C)C1CCC(=O)O1)C1COC(=O)C1 |
| InChI | InChI=1S/C23H38O5/c1-22(2,17-15-21(26)27-16-17)13-7-5-9-18(24)10-6-8-14-23(3,4)19-11-12-20(25)28-19/h17,19H,5-16H2,1-4H3 |
| InChIKey | FNMRHYOYAGTRHG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|