C25H36N4O6S2 — CID 11563036
1-[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]-3-[3-[[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]carbamothioylamino]propyl]thiourea (PubChem CID 11563036) has the molecular formula C25H36N4O6S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is 1-[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]-3-[3-[[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]carbamothioylamino]propyl]thiourea.
| Compound Name | 1-[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]-3-[3-[[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]carbamothioylamino]propyl]thiourea |
|---|---|
| PubChem CID | 11563036 |
| Molecular Formula | C25H36N4O6S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 1-[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]-3-[3-[[3-(5-hydroxy-4-oxopyran-3-yl)-3-methylbutyl]carbamothioylamino]propyl]thiourea |
| SMILES | CC(C)(CCNC(=S)NCCCNC(=S)NCCC(C)(C)c1cocc(O)c1=O)c1cocc(O)c1=O |
| InChI | InChI=1S/C25H36N4O6S2/c1-24(2,16-12-34-14-18(30)20(16)32)6-10-28-22(36)26-8-5-9-27-23(37)29-11-7-25(3,4)17-13-35-15-19(31)21(17)33/h12-15,30-31H,5-11H2,1-4H3,(H2,26,28,36)(H2,27,29,37) |
| InChIKey | SGNLSKKLTGOWNH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|