C23H36N2OS — CID 11668227
(5Z,8Z,11Z,14Z)-19-isothiocyanato-N-propan-2-ylnonadeca-5,8,11,14-tetraenamide (PubChem CID 11668227) has the molecular formula C23H36N2OS and a molecular weight of 388.62 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-19-isothiocyanato-N-propan-2-ylnonadeca-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-19-isothiocyanato-N-propan-2-ylnonadeca-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 11668227 |
| Molecular Formula | C23H36N2OS |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-19-isothiocyanato-N-propan-2-ylnonadeca-5,8,11,14-tetraenamide |
| SMILES | CC(C)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCN=C=S |
| InChI | InChI=1S/C23H36N2OS/c1-22(2)25-23(26)19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-24-21-27/h4-7,10-13,22H,3,8-9,14-20H2,1-2H3,(H,25,26)/b6-4-,7-5-,12-10-,13-11- |
| InChIKey | JPDJMZUWRNMXER-XBOCNYGYSA-N |
| XLogP | 6.35 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|