C23H29N3O3 — CID 11668383
2-[[(2R,3R)-2-amino-9-methoxy-3-(3-methylphenyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-8-yl]oxy]acetamide (PubChem CID 11668383) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[[(2R,3R)-2-amino-9-methoxy-3-(3-methylphenyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-8-yl]oxy]acetamide.
| Compound Name | 2-[[(2R,3R)-2-amino-9-methoxy-3-(3-methylphenyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-8-yl]oxy]acetamide |
|---|---|
| PubChem CID | 11668383 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 2-[[(2R,3R)-2-amino-9-methoxy-3-(3-methylphenyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-8-yl]oxy]acetamide |
| SMILES | COc1ccc2c(c1OCC(N)=O)CCN1C[C@@H](c3cccc(C)c3)[C@H](N)CC21 |
| InChI | InChI=1S/C23H29N3O3/c1-14-4-3-5-15(10-14)18-12-26-9-8-17-16(20(26)11-19(18)24)6-7-21(28-2)23(17)29-13-22(25)27/h3-7,10,18-20H,8-9,11-13,24H2,1-2H3,(H2,25,27)/t18-,19+,20?/m0/s1 |
| InChIKey | DMDZKPLXNQHSIG-ABZYKWASSA-N |
| XLogP | 2.28 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |