C24H27F3O2 — CID 11668558
[(2S)-2-(4-methylphenyl)hept-6-enyl] 3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 11668558) has the molecular formula C24H27F3O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is [(2S)-2-(4-methylphenyl)hept-6-enyl] 3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | [(2S)-2-(4-methylphenyl)hept-6-enyl] 3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 11668558 |
| Molecular Formula | C24H27F3O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [(2S)-2-(4-methylphenyl)hept-6-enyl] 3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | C=CCCC[C@H](COC(=O)CCc1ccc(C(F)(F)F)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27F3O2/c1-3-4-5-6-21(20-12-7-18(2)8-13-20)17-29-23(28)16-11-19-9-14-22(15-10-19)24(25,26)27/h3,7-10,12-15,21H,1,4-6,11,16-17H2,2H3/t21-/m1/s1 |
| InChIKey | OPVCWGPDHWBDOT-OAQYLSRUSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|