About N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine
N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine (PubChem CID 116699027) has the molecular formula C14H17ClF3NS
and a molecular weight of 323.81 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine.
Molecular Properties
| Compound Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine |
| PubChem CID | 116699027 |
| Molecular Formula | C14H17ClF3NS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(Nc2cc(Cl)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H17ClF3NS/c1-13(2)6-12(7-20-8-13)19-11-4-9(14(16,17)18)3-10(15)5-11/h3-5,12,19H,6-8H2,1-2H3 |
| InChIKey | NTQHHFYLLRUIKL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine?
The IUPAC name of N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine (CID 116699027) is N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine.
What is the SMILES notation for N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine?
The canonical SMILES for N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine is CC1(C)CSCC(Nc2cc(Cl)cc(C(F)(F)F)c2)C1.
What is the InChIKey of N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine?
The InChIKey is NTQHHFYLLRUIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClF3NS/c1-13(2)6-12(7-20-8-13)19-11-4-9(14(16,17)18)3-10(15)5-11/h3-5,12,19H,6-8H2,1-2H3.
What are the key properties of N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine?
N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine has a molecular weight of 323.81 g/mol, XLogP of 5.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-5-(trifluoromethyl)phenyl]-5,5-dimethylthian-3-amine is sourced from PubChem (CID 116699027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).