C14H19FO2 — CID 116709501
1-(4-fluorophenyl)-3-methoxy-4,4-dimethylpentan-2-one (PubChem CID 116709501) has the molecular formula C14H19FO2 and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-methoxy-4,4-dimethylpentan-2-one.
| Compound Name | 1-(4-fluorophenyl)-3-methoxy-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 116709501 |
| Molecular Formula | C14H19FO2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-methoxy-4,4-dimethylpentan-2-one |
| SMILES | COC(C(=O)Cc1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H19FO2/c1-14(2,3)13(17-4)12(16)9-10-5-7-11(15)8-6-10/h5-8,13H,9H2,1-4H3 |
| InChIKey | VDYBWHFTGNDFQA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |