C12H26O3 — CID 116713153
1,5-dimethoxy-3,6,6-trimethylheptan-4-ol (PubChem CID 116713153) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1,5-dimethoxy-3,6,6-trimethylheptan-4-ol.
| Compound Name | 1,5-dimethoxy-3,6,6-trimethylheptan-4-ol |
|---|---|
| PubChem CID | 116713153 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 1,5-dimethoxy-3,6,6-trimethylheptan-4-ol |
| SMILES | COCCC(C)C(O)C(OC)C(C)(C)C |
| InChI | InChI=1S/C12H26O3/c1-9(7-8-14-5)10(13)11(15-6)12(2,3)4/h9-11,13H,7-8H2,1-6H3 |
| InChIKey | PKRBARKKAFWHBX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |