C10H22O — CID 177079402
(3R,4R)-3-methoxy-2,2,4-trimethylhexane (PubChem CID 177079402) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is (3R,4R)-3-methoxy-2,2,4-trimethylhexane.
| Compound Name | (3R,4R)-3-methoxy-2,2,4-trimethylhexane |
|---|---|
| PubChem CID | 177079402 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | (3R,4R)-3-methoxy-2,2,4-trimethylhexane |
| SMILES | CC[C@@H](C)[C@@H](OC)C(C)(C)C |
| InChI | InChI=1S/C10H22O/c1-7-8(2)9(11-6)10(3,4)5/h8-9H,7H2,1-6H3/t8-,9-/m1/s1 |
| InChIKey | DPIILXLCDISNGD-RKDXNWHRSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |