C14H21FO3 — CID 116713778
3-ethoxy-1-(3-fluoro-4-methoxyphenyl)-3-methylbutan-2-ol (PubChem CID 116713778) has the molecular formula C14H21FO3 and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-ethoxy-1-(3-fluoro-4-methoxyphenyl)-3-methylbutan-2-ol.
| Compound Name | 3-ethoxy-1-(3-fluoro-4-methoxyphenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 116713778 |
| Molecular Formula | C14H21FO3 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-ethoxy-1-(3-fluoro-4-methoxyphenyl)-3-methylbutan-2-ol |
| SMILES | CCOC(C)(C)C(O)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C14H21FO3/c1-5-18-14(2,3)13(16)9-10-6-7-12(17-4)11(15)8-10/h6-8,13,16H,5,9H2,1-4H3 |
| InChIKey | QIXHGWLYTSFZJR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |