C15H24O3 — CID 63018220
1-(3,4-dimethoxyphenyl)-3,3-dimethylpentan-2-ol (PubChem CID 63018220) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3,3-dimethylpentan-2-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3,3-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 63018220 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3,3-dimethylpentan-2-ol |
| SMILES | CCC(C)(C)C(O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24O3/c1-6-15(2,3)14(16)10-11-7-8-12(17-4)13(9-11)18-5/h7-9,14,16H,6,10H2,1-5H3 |
| InChIKey | HXTPDJOMHSCHPF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |