C14H28F3NO — CID 116721701
3-ethoxy-8,8,8-trifluoro-2-methyl-N-propyloctan-4-amine (PubChem CID 116721701) has the molecular formula C14H28F3NO and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-ethoxy-8,8,8-trifluoro-2-methyl-N-propyloctan-4-amine.
| Compound Name | 3-ethoxy-8,8,8-trifluoro-2-methyl-N-propyloctan-4-amine |
|---|---|
| PubChem CID | 116721701 |
| Molecular Formula | C14H28F3NO |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 3-ethoxy-8,8,8-trifluoro-2-methyl-N-propyloctan-4-amine |
| SMILES | CCCNC(CCCC(F)(F)F)C(OCC)C(C)C |
| InChI | InChI=1S/C14H28F3NO/c1-5-10-18-12(8-7-9-14(15,16)17)13(11(3)4)19-6-2/h11-13,18H,5-10H2,1-4H3 |
| InChIKey | OZAAWKYTFOWHNF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |