C13H10N2O3S2 — CID 11673932
(2Z)-2-cyano-N-(4-methoxyphenyl)-2-(4-oxo-1,3-dithiolan-2-ylidene)acetamide (PubChem CID 11673932) has the molecular formula C13H10N2O3S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (2Z)-2-cyano-N-(4-methoxyphenyl)-2-(4-oxo-1,3-dithiolan-2-ylidene)acetamide.
| Compound Name | (2Z)-2-cyano-N-(4-methoxyphenyl)-2-(4-oxo-1,3-dithiolan-2-ylidene)acetamide |
|---|---|
| PubChem CID | 11673932 |
| Molecular Formula | C13H10N2O3S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | (2Z)-2-cyano-N-(4-methoxyphenyl)-2-(4-oxo-1,3-dithiolan-2-ylidene)acetamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C2/SCC(=O)S2)cc1 |
| InChI | InChI=1S/C13H10N2O3S2/c1-18-9-4-2-8(3-5-9)15-12(17)10(6-14)13-19-7-11(16)20-13/h2-5H,7H2,1H3,(H,15,17)/b13-10- |
| InChIKey | MZFIQBXBPULEAQ-RAXLEYEMSA-N |
| XLogP | 2.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|