C26H21N5O3S — CID 56970140
(2Z)-2-cyano-2-[(5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide (PubChem CID 56970140) has the molecular formula C26H21N5O3S and a molecular weight of 483.55 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[(5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide.
| Compound Name | (2Z)-2-cyano-2-[(5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 56970140 |
| Molecular Formula | C26H21N5O3S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (2Z)-2-cyano-2-[(5Z)-5-[(4-methoxyphenyl)hydrazinylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-(4-methylphenyl)acetamide |
| SMILES | COc1ccc(N/N=C2\S/C(=C(/C#N)C(=O)Nc3ccc(C)cc3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H21N5O3S/c1-17-8-10-18(11-9-17)28-23(32)22(16-27)26-31(20-6-4-3-5-7-20)25(33)24(35-26)30-29-19-12-14-21(34-2)15-13-19/h3-15,29H,1-2H3,(H,28,32)/b26-22-,30-24- |
| InChIKey | RTPJEMRUXZSPKW-IUBPNNFHSA-N |
| XLogP | 4.88 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|