C12H16BrFN2 — CID 116739867
7-bromo-2-butan-2-yl-6-fluoro-1,2,3,4-tetrahydroquinoxaline (PubChem CID 116739867) has the molecular formula C12H16BrFN2 and a molecular weight of 287.18 g/mol. Its IUPAC name is 7-bromo-2-butan-2-yl-6-fluoro-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 7-bromo-2-butan-2-yl-6-fluoro-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 116739867 |
| Molecular Formula | C12H16BrFN2 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 7-bromo-2-butan-2-yl-6-fluoro-1,2,3,4-tetrahydroquinoxaline |
| SMILES | CCC(C)C1CNc2cc(F)c(Br)cc2N1 |
| InChI | InChI=1S/C12H16BrFN2/c1-3-7(2)12-6-15-10-5-9(14)8(13)4-11(10)16-12/h4-5,7,12,15-16H,3,6H2,1-2H3 |
| InChIKey | GMJDVVRWJWEGIV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |