C11H12BrFN2O — CID 116739917
8-bromo-7-fluoro-3,3a,4,5,10,10a-hexahydro-1H-furo[3,4-b][1,5]benzodiazepine (PubChem CID 116739917) has the molecular formula C11H12BrFN2O and a molecular weight of 287.13 g/mol. Its IUPAC name is 8-bromo-7-fluoro-3,3a,4,5,10,10a-hexahydro-1H-furo[3,4-b][1,5]benzodiazepine.
| Compound Name | 8-bromo-7-fluoro-3,3a,4,5,10,10a-hexahydro-1H-furo[3,4-b][1,5]benzodiazepine |
|---|---|
| PubChem CID | 116739917 |
| Molecular Formula | C11H12BrFN2O |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 8-bromo-7-fluoro-3,3a,4,5,10,10a-hexahydro-1H-furo[3,4-b][1,5]benzodiazepine |
| SMILES | Fc1cc2c(cc1Br)NC1COCC1CN2 |
| InChI | InChI=1S/C11H12BrFN2O/c12-7-1-10-9(2-8(7)13)14-3-6-4-16-5-11(6)15-10/h1-2,6,11,14-15H,3-5H2 |
| InChIKey | NLOFOBDWUMCWLI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |