C15H29BrSi — CID 11674112
[(E,3Z)-3-(bromomethylidene)-2-butylhept-1-enyl]-trimethylsilane (PubChem CID 11674112) has the molecular formula C15H29BrSi and a molecular weight of 317.39 g/mol. Its IUPAC name is [(E,3Z)-3-(bromomethylidene)-2-butylhept-1-enyl]-trimethylsilane.
| Compound Name | [(E,3Z)-3-(bromomethylidene)-2-butylhept-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11674112 |
| Molecular Formula | C15H29BrSi |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [(E,3Z)-3-(bromomethylidene)-2-butylhept-1-enyl]-trimethylsilane |
| SMILES | CCCCC(=C/Br)/C(=C/[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C15H29BrSi/c1-6-8-10-14(12-16)15(11-9-7-2)13-17(3,4)5/h12-13H,6-11H2,1-5H3/b14-12-,15-13+ |
| InChIKey | HCHFUGGDQOIMTG-PMJBJKLVSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|