C18H37BrSi2 — CID 139249951
[(Z,3E)-1-bromo-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane (PubChem CID 139249951) has the molecular formula C18H37BrSi2 and a molecular weight of 389.57 g/mol. Its IUPAC name is [(Z,3E)-1-bromo-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane.
| Compound Name | [(Z,3E)-1-bromo-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 139249951 |
| Molecular Formula | C18H37BrSi2 |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [(Z,3E)-1-bromo-2-butyl-3-(trimethylsilylmethylidene)hept-1-enyl]-trimethylsilane |
| SMILES | CCCCC(=C(/Br)[Si](C)(C)C)/C(=C/[Si](C)(C)C)CCCC |
| InChI | InChI=1S/C18H37BrSi2/c1-9-11-13-16(15-20(3,4)5)17(14-12-10-2)18(19)21(6,7)8/h15H,9-14H2,1-8H3/b16-15+,18-17+ |
| InChIKey | FGLFXMLDZTVRAK-GKIXDJALSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|