C15H18BrFO3 — CID 116748785
2-(2-bromo-5-fluorophenyl)-1-(4-ethoxyoxan-4-yl)ethanone (PubChem CID 116748785) has the molecular formula C15H18BrFO3 and a molecular weight of 345.21 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-1-(4-ethoxyoxan-4-yl)ethanone.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-1-(4-ethoxyoxan-4-yl)ethanone |
|---|---|
| PubChem CID | 116748785 |
| Molecular Formula | C15H18BrFO3 |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-1-(4-ethoxyoxan-4-yl)ethanone |
| SMILES | CCOC1(C(=O)Cc2cc(F)ccc2Br)CCOCC1 |
| InChI | InChI=1S/C15H18BrFO3/c1-2-20-15(5-7-19-8-6-15)14(18)10-11-9-12(17)3-4-13(11)16/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | ZTUHPRIVQHZQIU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |