C15H21ClO4 — CID 116754035
2-(5-chloro-2-methoxyphenyl)-1-(4-methoxyoxan-4-yl)ethanol (PubChem CID 116754035) has the molecular formula C15H21ClO4 and a molecular weight of 300.78 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-1-(4-methoxyoxan-4-yl)ethanol.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-1-(4-methoxyoxan-4-yl)ethanol |
|---|---|
| PubChem CID | 116754035 |
| Molecular Formula | C15H21ClO4 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-1-(4-methoxyoxan-4-yl)ethanol |
| SMILES | COc1ccc(Cl)cc1CC(O)C1(OC)CCOCC1 |
| InChI | InChI=1S/C15H21ClO4/c1-18-13-4-3-12(16)9-11(13)10-14(17)15(19-2)5-7-20-8-6-15/h3-4,9,14,17H,5-8,10H2,1-2H3 |
| InChIKey | PVRSYOZUJMTKNU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |