C14H24BrN3O — CID 116776781
5-bromo-2-(2-ethoxybutan-2-yl)-N,6-diethylpyrimidin-4-amine (PubChem CID 116776781) has the molecular formula C14H24BrN3O and a molecular weight of 330.27 g/mol. Its IUPAC name is 5-bromo-2-(2-ethoxybutan-2-yl)-N,6-diethylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(2-ethoxybutan-2-yl)-N,6-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116776781 |
| Molecular Formula | C14H24BrN3O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 5-bromo-2-(2-ethoxybutan-2-yl)-N,6-diethylpyrimidin-4-amine |
| SMILES | CCNc1nc(C(C)(CC)OCC)nc(CC)c1Br |
| InChI | InChI=1S/C14H24BrN3O/c1-6-10-11(15)12(16-8-3)18-13(17-10)14(5,7-2)19-9-4/h6-9H2,1-5H3,(H,16,17,18) |
| InChIKey | BYTJSTJRRGKFIU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |