C14H14N4O — CID 116782061
4-amino-2-[methoxy(phenyl)methyl]-6-methylpyrimidine-5-carbonitrile (PubChem CID 116782061) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-amino-2-[methoxy(phenyl)methyl]-6-methylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[methoxy(phenyl)methyl]-6-methylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 116782061 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-amino-2-[methoxy(phenyl)methyl]-6-methylpyrimidine-5-carbonitrile |
| SMILES | COC(c1ccccc1)c1nc(C)c(C#N)c(N)n1 |
| InChI | InChI=1S/C14H14N4O/c1-9-11(8-15)13(16)18-14(17-9)12(19-2)10-6-4-3-5-7-10/h3-7,12H,1-2H3,(H2,16,17,18) |
| InChIKey | ZAHUNWRMXBPLRK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |