C15H16ClN3S — CID 116785087
N-(5-chloroquinolin-8-yl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine (PubChem CID 116785087) has the molecular formula C15H16ClN3S and a molecular weight of 305.83 g/mol. Its IUPAC name is N-(5-chloroquinolin-8-yl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(5-chloroquinolin-8-yl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 116785087 |
| Molecular Formula | C15H16ClN3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(5-chloroquinolin-8-yl)-4-ethyl-4-methyl-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(C)CSC(Nc2ccc(Cl)c3cccnc23)=N1 |
| InChI | InChI=1S/C15H16ClN3S/c1-3-15(2)9-20-14(19-15)18-12-7-6-11(16)10-5-4-8-17-13(10)12/h4-8H,3,9H2,1-2H3,(H,18,19) |
| InChIKey | QAHXMQNURMBQNN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |