C14H20F2O — CID 116790326
5,5-difluoro-5-phenyl-3-propan-2-ylpentan-2-ol (PubChem CID 116790326) has the molecular formula C14H20F2O and a molecular weight of 242.31 g/mol. Its IUPAC name is 5,5-difluoro-5-phenyl-3-propan-2-ylpentan-2-ol.
| Compound Name | 5,5-difluoro-5-phenyl-3-propan-2-ylpentan-2-ol |
|---|---|
| PubChem CID | 116790326 |
| Molecular Formula | C14H20F2O |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 5,5-difluoro-5-phenyl-3-propan-2-ylpentan-2-ol |
| SMILES | CC(C)C(CC(F)(F)c1ccccc1)C(C)O |
| InChI | InChI=1S/C14H20F2O/c1-10(2)13(11(3)17)9-14(15,16)12-7-5-4-6-8-12/h4-8,10-11,13,17H,9H2,1-3H3 |
| InChIKey | GRJUVCLOWGIXSW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |