C8H5BrF2N4 — CID 116799260
2-(2-bromo-4,6-difluorophenyl)triazol-4-amine (PubChem CID 116799260) has the molecular formula C8H5BrF2N4 and a molecular weight of 275.06 g/mol. Its IUPAC name is 2-(2-bromo-4,6-difluorophenyl)triazol-4-amine.
| Compound Name | 2-(2-bromo-4,6-difluorophenyl)triazol-4-amine |
|---|---|
| PubChem CID | 116799260 |
| Molecular Formula | C8H5BrF2N4 |
| Molecular Weight | 275.06 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-(2-bromo-4,6-difluorophenyl)triazol-4-amine |
| SMILES | Nc1cnn(-c2c(F)cc(F)cc2Br)n1 |
| InChI | InChI=1S/C8H5BrF2N4/c9-5-1-4(10)2-6(11)8(5)15-13-3-7(12)14-15/h1-3H,(H2,12,14) |
| InChIKey | QVQFOFRANKBEQE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |