C8H6F2N4 — CID 82399873
2-(3,5-difluorophenyl)triazol-4-amine (PubChem CID 82399873) has the molecular formula C8H6F2N4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)triazol-4-amine.
| Compound Name | 2-(3,5-difluorophenyl)triazol-4-amine |
|---|---|
| PubChem CID | 82399873 |
| Molecular Formula | C8H6F2N4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-(3,5-difluorophenyl)triazol-4-amine |
| SMILES | Nc1cnn(-c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C8H6F2N4/c9-5-1-6(10)3-7(2-5)14-12-4-8(11)13-14/h1-4H,(H2,11,13) |
| InChIKey | WKTXADSRWRPFSX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |