C11H20ClNO — CID 11680136
(4S)-4-tert-butyl-2-(1-chloro-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 11680136) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is (4S)-4-tert-butyl-2-(1-chloro-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-tert-butyl-2-(1-chloro-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11680136 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (4S)-4-tert-butyl-2-(1-chloro-2-methylpropan-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)(CCl)C1=N[C@@H](C(C)(C)C)CO1 |
| InChI | InChI=1S/C11H20ClNO/c1-10(2,3)8-6-14-9(13-8)11(4,5)7-12/h8H,6-7H2,1-5H3/t8-/m1/s1 |
| InChIKey | RJHBSWHTZMKNJY-MRVPVSSYSA-N |
| XLogP | 3.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|