C12H14ClN3O3S — CID 116814888
4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide (PubChem CID 116814888) has the molecular formula C12H14ClN3O3S and a molecular weight of 315.78 g/mol. Its IUPAC name is 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116814888 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-chloro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCCl)Nc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H14ClN3O3S/c13-8-4-5-9-20(17,18)16-12-15-14-11(19-12)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,15,16) |
| InChIKey | QRDWOPOOFGABQM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|