C11H11Cl2N — CID 116817554
2,2-dichloro-3-(2,4-dimethylphenyl)propanenitrile (PubChem CID 116817554) has the molecular formula C11H11Cl2N and a molecular weight of 228.12 g/mol. Its IUPAC name is 2,2-dichloro-3-(2,4-dimethylphenyl)propanenitrile.
| Compound Name | 2,2-dichloro-3-(2,4-dimethylphenyl)propanenitrile |
|---|---|
| PubChem CID | 116817554 |
| Molecular Formula | C11H11Cl2N |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2,2-dichloro-3-(2,4-dimethylphenyl)propanenitrile |
| SMILES | Cc1ccc(CC(Cl)(Cl)C#N)c(C)c1 |
| InChI | InChI=1S/C11H11Cl2N/c1-8-3-4-10(9(2)5-8)6-11(12,13)7-14/h3-5H,6H2,1-2H3 |
| InChIKey | AUHMLDACVURHIQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|